For research use only. Not for therapeutic Use.
4-(Triphenylethenyl)aniline (Cat.No:L004098) is a significant chemical compound in materials science. Its unique structure, incorporating a triphenylethenyl and aniline group, imparts specialized properties. This compound is employed as a key component in the synthesis of specialized materials, particularly in the field of organic electronics and optoelectronics.
| CAS Number | 919789-80-3 |
| Molecular Formula | C26H21N |
| Purity | ≥95% |
| IUPAC Name | 4-(1,2,2-triphenylethenyl)aniline |
| InChI | InChI=1S/C26H21N/c27-24-18-16-23(17-19-24)26(22-14-8-3-9-15-22)25(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-19H,27H2 |
| InChIKey | WCNQRPKNQRXHQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)N)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
