4-Thiouridine (4-SU) is a photoactivatable ribonucleoside analog that is widely used for RNA analysis, including short-range RNA-RNA crosslinking and nascent RNA labeling. The crosslinking thio moiety is attached directly to the nucleotide base, thus 4-SU differs from uridine only by a single sulfur substitution. This offers the advantage of incorporating into an RNA chain with minimal structural perturbation and with similar base-pairing properties, reducing the likelihood that substitution will impair RNA interactions or activities.
| Catalog Number | R053766 |
| CAS Number | 13957-31-8 |
| Synonyms | Thiouridine; NSC 518132; |
| Molecular Formula | C9H12N2O5S |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
| InChI | InChI=1S/C9H12N2O5S/c12-3-4-6(13)7(14)8(16-4)11-2-1-5(17)10-9(11)15/h1-2,4,6-8,12-14H,3H2,(H,10,15,17)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | ZLOIGESWDJYCTF-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)NC1=S)C2C(C(C(O2)CO)O)O |
