For research use only. Not for therapeutic Use.
4-(tert-Butyl)picolinimidamide hydrochloride(Cat No.:L035077)is an organic compound featuring a picolinimidamide core with a tert-butyl group at the 4-position, presented as a hydrochloride salt for increased stability and solubility. This compound is primarily used as an intermediate in the synthesis of pharmaceuticals and agrochemicals, where the tert-butyl group provides steric hindrance, influencing the compound’s reactivity and selectivity in chemical reactions. The imidamide functionality allows for further modifications, making it a valuable building block in medicinal chemistry for developing bioactive molecules with potential therapeutic applications.
CAS Number | 949010-62-2 |
Molecular Formula | C10H16ClN3 |
Purity | ≥95% |
IUPAC Name | 4-tert-butylpyridine-2-carboximidamide;hydrochloride |
InChI | InChI=1S/C10H15N3.ClH/c1-10(2,3)7-4-5-13-8(6-7)9(11)12;/h4-6H,1-3H3,(H3,11,12);1H |
InChIKey | GRNFKWSBGAPTQE-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC(=NC=C1)C(=N)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |