For research use only. Not for therapeutic Use.
4-tert-Butyl-3-chloroaniline(Cat No.:L007685), is a chemical compound featuring a chloro-substituted aniline ring with a tert-butyl group at the 4-position. This specific molecular structure is significant in organic synthesis and chemical research. Researchers utilize it as a key intermediate in the creation of various organic compounds, especially in the synthesis of dyes, pigments, and agrochemicals. Its versatile nature allows for diverse chemical modifications, making it valuable in the design and synthesis of novel compounds for industrial applications, contributing to advancements in chemical research and the development of specialized chemicals for commercial use.
| CAS Number | 52756-36-2 |
| Molecular Formula | C10H14ClN |
| Purity | ≥95% |
| IUPAC Name | 4-tert-butyl-3-chloroaniline |
| InChI | InChI=1S/C10H14ClN/c1-10(2,3)8-5-4-7(12)6-9(8)11/h4-6H,12H2,1-3H3 |
| InChIKey | CFMUKZISSXYPBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C=C1)N)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |