For research use only. Not for therapeutic Use.
4-Pyridylmethanol N-oxide(Cat No.:L007138), is a chemical compound with the molecular formula C6H7NO2. It consists of a pyridine ring substituted with a hydroxyl group (-OH) and a N-oxide group (-NO) at the 4th position. This compound is significant in organic synthesis and medicinal chemistry research, often employed as a valuable intermediate for the synthesis of various biologically active molecules. Its unique structure and reactivity make it important for drug discovery, enabling the creation of specialized pharmaceuticals. Researchers utilize 4-Pyridylmethanol N-oxide to develop new drugs and study their potential therapeutic applications in various fields of medicine.
CAS Number | 22346-75-4 |
Molecular Formula | C6H7NO2 |
Purity | ≥95% |
IUPAC Name | (1-oxidopyridin-1-ium-4-yl)methanol |
InChI | InChI=1S/C6H7NO2/c8-5-6-1-3-7(9)4-2-6/h1-4,8H,5H2 |
InChIKey | ZJGXPKKVSNSGRJ-UHFFFAOYSA-N |
SMILES | C1=C[N+](=CC=C1CO)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |