For research use only. Not for therapeutic Use.
(4-(Pyridin-2-yl)piperidin-4-yl)methanamine(CAT: L000123) is a compound of importance in pharmaceutical and organic chemistry. It serves as a key intermediate in the synthesis of various pharmaceutical and bioactive molecules. Its structure allows it to participate in diverse chemical reactions, making it valuable for the creation of complex compounds and pharmaceutical intermediates. In the pharmaceutical and organic chemistry fields, this compound is used as a building block for the preparation of novel drug candidates, contributing to the advancement of medications for a range of medical conditions.
CAS Number | 1501149-78-5 |
Molecular Formula | C11H17N3 |
Purity | ≥95% |
IUPAC Name | (4-pyridin-2-ylpiperidin-4-yl)methanamine |
InChI | InChI=1S/C11H17N3/c12-9-11(4-7-13-8-5-11)10-3-1-2-6-14-10/h1-3,6,13H,4-5,7-9,12H2 |
InChIKey | VUSCKFGKQQYPAP-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |