For research use only. Not for therapeutic Use.
4-PQBH（Cat No.:I044125）is a synthetic compound known for its role as an inhibitor of NADPH oxidase (NOX) enzymes, particularly NOX2. By reducing reactive oxygen species (ROS) production, 4-PQBH helps modulate oxidative stress pathways involved in inflammation, cardiovascular dysfunction, and neurodegenerative diseases. It is widely used in preclinical studies to explore the pathological roles of NOX-derived ROS and to assess the therapeutic potential of NOX inhibition. 4-PQBH serves as a valuable pharmacological tool for investigating oxidative damage mechanisms and developing treatments targeting redox imbalance in chronic inflammatory and oxidative stress-related disorders.
| CAS Number | 2243355-51-1 |
| Synonyms | N-[(E)-pyridin-4-ylmethylideneamino]-4-(quinolin-4-ylamino)benzamide |
| Molecular Formula | C22H17N5O |
| Purity | ≥95% |
| IUPAC Name | N-[(E)-pyridin-4-ylmethylideneamino]-4-(quinolin-4-ylamino)benzamide |
| InChI | InChI=1S/C22H17N5O/c28-22(27-25-15-16-9-12-23-13-10-16)17-5-7-18(8-6-17)26-21-11-14-24-20-4-2-1-3-19(20)21/h1-15H,(H,24,26)(H,27,28)/b25-15+ |
| InChIKey | AVTFCFMDUCRAQC-MFKUBSTISA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)NC3=CC=C(C=C3)C(=O)N/N=C/C4=CC=NC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
