For research use only. Not for therapeutic Use.
4-(Phenylthio)-1,2-benzenediamine is an organic compound characterized by a benzene ring substituted with an amine group at the 1 and 2 positions and a phenylthio group at the 4 position. This structure imparts unique chemical properties, making it useful as an intermediate in the synthesis of dyes, pharmaceuticals, and other specialty chemicals. Its ability to act as a ligand in coordination chemistry also extends its applications to materials science and catalysis research.
CAS Number | 43156-48-5 |
Synonyms | 1,2-Diamino-4-phenylthiobenzene; 4-Phenylsulfenyl-o-phenylenediamine; 4-Thiophenoxy-1,2-phenylenediamine; 5-(Phenylthio)-1,2-benzenediamine |
Molecular Formula | C12H12N2S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-phenylsulfanylbenzene-1,2-diamine |
InChI | InChI=1S/C12H12N2S/c13-11-7-6-10(8-12(11)14)15-9-4-2-1-3-5-9/h1-8H,13-14H2 |
InChIKey | YLEPPBFOGUYOEI-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)SC2=CC(=C(C=C2)N)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |