For research use only. Not for therapeutic Use.
4-Phenylpyrimidine-2-carboxylic acid is a heterocyclic compound used in pharmaceutical research and organic synthesis. Its structure consists of a pyrimidine ring with a phenyl group at the 4-position and a carboxylic acid group at the 2-position. This combination of functionalities makes it a versatile building block for developing bioactive molecules, including potential therapeutic agents such as enzyme inhibitors or receptor modulators. The compound’s reactivity and structure contribute to advancements in medicinal chemistry, particularly in drug discovery and the synthesis of complex organic molecules.
CAS Number | 74647-39-5 |
Molecular Formula | C11H8N2O2 |
Purity | ≥95% |
IUPAC Name | 4-phenylpyrimidine-2-carboxylic acid |
InChI | InChI=1S/C11H8N2O2/c14-11(15)10-12-7-6-9(13-10)8-4-2-1-3-5-8/h1-7H,(H,14,15) |
InChIKey | OKGSNIRNGQVKJO-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |