For research use only. Not for therapeutic Use.
4-Phenyl-1H-1,2,3-triazole(CAT: M124023) is a heterocyclic compound featuring a triazole ring substituted with a phenyl group. It is widely used in medicinal chemistry, material science, and drug discovery due to its stability and bioactive properties. As a key scaffold in pharmaceuticals, it serves as a core structure in numerous biologically active molecules, including anticancer, antifungal, and antimicrobial agents. Additionally, 4-Phenyl-1H-1,2,3-triazole is valuable in click chemistry reactions, where it is utilized in bioconjugation and ligand design. Its versatility makes it a crucial component in the development of novel therapeutics and functional materials.
| CAS Number | 1680-44-0 |
| Synonyms | 4-phenyl-2H-triazole |
| Molecular Formula | C8H7N3 |
| Purity | ≥95% |
| IUPAC Name | 4-phenyl-2H-triazole |
| InChI | InChI=1S/C8H7N3/c1-2-4-7(5-3-1)8-6-9-11-10-8/h1-6H,(H,9,10,11) |
| InChIKey | LUEYUHCBBXWTQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNN=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
