For research use only. Not for therapeutic Use.
4-Phenoxypyrimidin-2-amine(Cat No.:L007844), is a chemical compound consisting of a pyrimidine ring substituted with an amino group at the 2-position and a phenoxyl group. Its molecular formula is C9H8N4O, representing its structural composition. Compounds like 4-phenoxypyrimidin-2-amine are important intermediates in organic synthesis and pharmaceutical research. Researchers might study its reactivity, and potential biological activities, or use it as a building block to create more complex molecules. The specific arrangement of its atoms makes it a valuable tool in the development of novel compounds for various applications.
| CAS Number | 882767-05-7 |
| Molecular Formula | C10H9N3O |
| Purity | ≥95% |
| IUPAC Name | 4-phenoxypyrimidin-2-amine |
| InChI | InChI=1S/C10H9N3O/c11-10-12-7-6-9(13-10)14-8-4-2-1-3-5-8/h1-7H,(H2,11,12,13) |
| InChIKey | JCHQIGPFCINYAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC(=NC=C2)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |