For research use only. Not for therapeutic Use.
4-(Perfluorohexyl) bromobenzene is a fluorinated aromatic compound used in advanced materials and pharmaceutical research. Featuring a perfluorohexyl group attached to a bromobenzene ring, this compound offers high chemical stability and unique hydrophobic properties. It is commonly employed as an intermediate in the synthesis of specialized polymers, surfactants, and bioactive molecules. Its structure makes it useful in developing fluorinated compounds for applications in drug delivery systems, coatings, and materials science, contributing to advancements in both industrial and pharmaceutical fields.
| CAS Number | 149068-56-4 |
| Synonyms | 4-(PERFLUOROHEXYL) BROMOBENZENE |
| Molecular Formula | C12H4BrF13 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 1-bromo-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzene |
| InChI | InChI=1S/C12H4BrF13/c13-6-3-1-5(2-4-6)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)26/h1-4H |
| InChIKey | GKOWYWPSKDBJAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |