Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-Oxopyridine-1(4H)-carboxylic acid tert-butyl ester
For research use only. Not for therapeutic Use.
4-Oxopyridine-1(4H)-carboxylic acid tert-butyl ester(Cat No.:L007362), is a chemical compound with relevance in organic synthesis and medicinal chemistry. It is characterized by a pyridine ring with a keto group at the 4-position and a tert-butyl ester functional group. This compound serves as a versatile building block in the creation of various heterocyclic structures, often employed in the synthesis of pharmaceuticals and biologically active molecules. Chemists use it to explore diverse chemical reactions and design novel compounds, contributing to advancements in drug discovery and organic chemistry research. Its versatility makes it valuable in the development of potential therapeutic agents and the study of complex chemical processes.
CAS Number | 332940-69-9 |
Molecular Formula | C10H13NO3 |
Purity | ≥95% |
IUPAC Name | tert-butyl 4-oxopyridine-1-carboxylate |
InChI | InChI=1S/C10H13NO3/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11/h4-7H,1-3H3 |
InChIKey | VVIBVBMWPUXVPK-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1C=CC(=O)C=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |