For research use only. Not for therapeutic Use.
4-Oxo-6-(2-oxo-5-vinylpyrrolidin-1-yl)hexanoic Acid (Cat No.:C000807) is a chemical compound characterized by a pyrrolidinyl group attached to a hexanoic acid backbone, with additional functional groups including a ketone and a vinyl substituent. This complex structure suggests potential applications in medicinal chemistry and drug development. The compound’s unique arrangement might contribute to interactions with biological systems, making it of interest to researchers exploring novel therapeutic agents.
CAS Number | 2512190-67-7 |
Synonyms | Vigabatrin Impurity 2; |
Molecular Formula | C₁₂H₁₇NO₄ |
Purity | ≥95% |
Solubility | DMSO (Slightly), Ethyl Acetate (Slightly) |
Appearance | Colourless to Off-White Thick Oil to Solid |
Storage | 4°C |
IUPAC Name | 6-(2-ethenyl-5-oxopyrrolidin-1-yl)-4-oxohexanoic acid |
InChI | InChI=1S/C12H17NO4/c1-2-9-3-5-11(15)13(9)8-7-10(14)4-6-12(16)17/h2,9H,1,3-8H2,(H,16,17) |
InChIKey | HJZHGIXQBNKRFN-UHFFFAOYSA-N |
SMILES | C=CC1CCC(=O)N1CCC(=O)CCC(=O)O |
Reference | Gogoi, S. et al.: ACS Med. Chem. Lett., 3, 991 (2012) |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |