For research use only. Not for therapeutic Use.
4-O-β-Glucopyranosyl-cis-coumaric acid(Cat No.:R072374)is a naturally occurring phenolic glycoside derived from coumaric acid. This compound consists of a cis-coumaric acid moiety linked through a glycosidic bond to a β-D-glucopyranose unit. It is commonly found in various plants, contributing to their antioxidant, anti-inflammatory, and potential antimicrobial activities. As a secondary metabolite, it plays a role in plant defense mechanisms and may support stress tolerance. In biomedical research, it attracts interest for its possible health-promoting effects, particularly in oxidative stress-related and inflammatory conditions.
CAS Number | 117405-48-8 |
Synonyms | (Z)-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid |
Molecular Formula | C15H18O8 |
Purity | ≥95% |
IUPAC Name | (Z)-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid |
InChI | InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-3-/t10-,12-,13+,14-,15-/m1/s1 |
InChIKey | LJFYQZQUAULRDF-LSSWKVNRSA-N |
SMILES | C1=CC(=CC=C1/C=C\C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |