For research use only. Not for therapeutic Use.
4-Nitrocatechol Sulfate Dipotassium Salt(CAT: I040866) is a chemical compound used primarily in Material Chemistry and Synthesis Chemistry. It acts as a precursor or intermediate in the synthesis of other organic compounds. The nitro group and sulfate ester functionalities make it reactive in various chemical transformations, including nucleophilic substitution and electrophilic aromatic substitution reactions. In addition to its use in chemical research, it can also play a role in the preparation of functionalized materials or as a probe in studies of redox reactions. Its versatility makes it a useful tool in developing new materials with specific electronic or chemical properties.
| CAS Number | 14528-64-4 |
| Synonyms | dipotassium;(5-nitro-2-oxidophenyl) sulfate |
| Molecular Formula | C6H3K2NO7S |
| Purity | ≥95% |
| IUPAC Name | dipotassium;(5-nitro-2-oxidophenyl) sulfate |
| InChI | InChI=1S/C6H5NO7S.2K/c8-5-2-1-4(7(9)10)3-6(5)14-15(11,12)13;;/h1-3,8H,(H,11,12,13);;/q;2*+1/p-2 |
| InChIKey | CKWWBDCAYRJAJB-UHFFFAOYSA-L |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])OS(=O)(=O)[O-])[O-].[K+].[K+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |