For research use only. Not for therapeutic Use.
4-N-Fmoc-amino-cyclohexanone is a cyclohexanone derivative featuring a fluorenylmethyloxycarbonyl (Fmoc) protecting group at the amino position. This compound is significant in peptide synthesis, where the Fmoc group serves as a temporary protecting group for amino functionalities, allowing for selective reactions. Its unique structure facilitates the incorporation of cyclohexanone into peptide chains, enhancing molecular diversity. The ability to easily remove the Fmoc group under mild conditions makes it a valuable intermediate in the design and synthesis of bioactive peptides and pharmaceuticals.
CAS Number | 391248-11-6 |
Molecular Formula | C21H21NO3 |
Purity | ≥95% |
IUPAC Name | 9H-fluoren-9-ylmethyl N-(4-oxocyclohexyl)carbamate |
InChI | InChI=1S/C21H21NO3/c23-15-11-9-14(10-12-15)22-21(24)25-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,14,20H,9-13H2,(H,22,24) |
InChIKey | PGHGDSRIILPGMC-UHFFFAOYSA-N |
SMILES | C1CC(=O)CCC1NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |