For research use only. Not for therapeutic Use.
(4-(Methyl(phenyl)carbamoyl)phenyl)boronic acid(CAT: L000543) is a chemically significant compound with versatile applications in organic and pharmaceutical chemistry. Its action method primarily involves its role as a key intermediate for the synthesis of various compounds. In pharmaceutical chemistry, it serves as a valuable building block for the development of potential drug candidates and bioactive molecules due to its specific structure.
CAS Number | 874219-49-5 |
Molecular Formula | C14H14BNO3 |
Purity | ≥95% |
IUPAC Name | [4-[methyl(phenyl)carbamoyl]phenyl]boronic acid |
InChI | InChI=1S/C14H14BNO3/c1-16(13-5-3-2-4-6-13)14(17)11-7-9-12(10-8-11)15(18)19/h2-10,18-19H,1H3 |
InChIKey | UGYPOYBNYVOGBD-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |