For research use only. Not for therapeutic Use.
4-Methylbenzo[h]quinoline is a polycyclic aromatic compound featuring a quinoline structure with a methyl group substitution at the 4th position. This compound is of interest in organic synthesis and materials science, often studied for its photophysical properties and potential use in organic electronics, such as organic light-emitting diodes (OLEDs) and photovoltaics. Additionally, derivatives of 4-methylbenzo[h]quinoline are explored for their potential biological activity, including anticancer and antimicrobial properties, making it relevant in both pharmaceutical and materials research.
CAS Number | 40174-37-6 |
Molecular Formula | C14H11N |
Purity | ≥95% |
IUPAC Name | 4-methylbenzo[h]quinoline |
InChI | InChI=1S/C14H11N/c1-10-8-9-15-14-12(10)7-6-11-4-2-3-5-13(11)14/h2-9H,1H3 |
InChIKey | RYLSMBLMTHOIEW-UHFFFAOYSA-N |
SMILES | CC1=C2C=CC3=CC=CC=C3C2=NC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |