For research use only. Not for therapeutic Use.
4’-Methylacetanilide(Cat No.:R013181), also known as p-toluidide or N-(4-methylphenyl)acetamide, is an organic compound featuring an acetamide group attached to a para-methylated aniline ring. It appears as a white crystalline solid and is primarily used as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. The para-methyl group enhances the electron-donating properties of the aromatic ring, influencing reactivity in electrophilic substitution reactions. Its structure is related to acetanilide derivatives, known for antipyretic and analgesic properties, though 4’-methylacetanilide is mostly valued for its role in synthetic applications.
| CAS Number | 103-89-9 |
| Synonyms | N-(4-methylphenyl)acetamide; 4-(Acetylamino)toluene; 4-Acetotoluide; 1-Acetamido-4-methylbenzene; N-p-Tolylacetamide; p-Acetotoluide; NSC 7644; |
| Molecular Formula | C9H11NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-(4-methylphenyl)acetamide |
| InChI | InChI=1S/C9H11NO/c1-7-3-5-9(6-4-7)10-8(2)11/h3-6H,1-2H3,(H,10,11) |
| InChIKey | YICAMJWHIUMFDI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |