For research use only. Not for therapeutic Use.
4-Methyl-7-nitro-1H-indole(CAT: L013960) is a high-purity heterocyclic compound featuring a methyl group and a nitro group on an indole core. This versatile molecule is widely utilized in pharmaceutical and chemical research, serving as a key intermediate in the synthesis of bioactive compounds and complex organic structures. Its unique combination of functional groups makes it particularly valuable in medicinal chemistry for developing novel therapeutic agents. With consistent quality and exceptional stability, 4-Methyl-7-nitro-1H-indole is an essential reagent for innovative research in drug discovery, organic synthesis, and material science.
CAS Number | 289483-80-3 |
Molecular Formula | C9H8N2O2 |
Purity | ≥95% |
IUPAC Name | 4-methyl-7-nitro-1H-indole |
InChI | InChI=1S/C9H8N2O2/c1-6-2-3-8(11(12)13)9-7(6)4-5-10-9/h2-5,10H,1H3 |
InChIKey | LXZHCIXJJSWNNT-UHFFFAOYSA-N |
SMILES | CC1=C2C=CNC2=C(C=C1)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |