For research use only. Not for therapeutic Use.
4-Methyl-5-vinylthiazole(Cat No.:R060171)is a heterocyclic aromatic compound featuring a thiazole ring substituted with a methyl group at position 4 and a vinyl group at position 5. This molecule is commonly found in flavor and fragrance chemistry due to its roasted, nutty aroma profile and is naturally present in cooked foods and Maillard reaction products. It also serves as a synthetic intermediate in pharmaceutical and agrochemical development, where the vinyl group enables further functionalization via addition or polymerization reactions. Its electron-rich thiazole ring contributes to biological activity and molecular recognition properties.
| CAS Number | 1759-28-0 |
| Synonyms | 4-Methyl-5-vinylthiazole; 4-Methyl-5-ethenylthiazole; 5-Ethenyl-4-methylthiazole; 5-Vinyl-4-methylthiazole |
| Molecular Formula | C6H7NS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-ethenyl-4-methyl-1,3-thiazole |
| InChI | InChI=1S/C6H7NS/c1-3-6-5(2)7-4-8-6/h3-4H,1H2,2H3 |
| InChIKey | QUAMMXIRDIIGDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C=C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |