For research use only. Not for therapeutic Use.
4-Methyl-3-heptanone(Cat No.:M014437) is an organic compound categorized as a ketone, specifically a medium-chain methyl ketone. This colorless liquid is characterized by a sharp, pungent odor that is often described as fruity or peppery. It is naturally found in certain plants and essential oils but can also be synthesized chemically. 4-Methyl-3-heptanone is commonly used in the fragrance and flavor industries to impart unique scents and flavors. Additionally, its solvent properties make it useful in various industrial applications, including the manufacture of plastics and other synthetic materials.
CAS Number | 6137-11-7 |
Synonyms | 4-METHYL-3-HEPTANONE;4-methyl-3-heptanon;4-Methylheptane-3-one;4-Methylheptan-3-one |
Molecular Formula | C8H16O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-methylheptan-3-one |
InChI | InChI=1S/C8H16O/c1-4-6-7(3)8(9)5-2/h7H,4-6H2,1-3H3 |
InChIKey | MVLRILUUXLBENA-UHFFFAOYSA-N |
SMILES | CCCC(C)C(=O)CC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |