For research use only. Not for therapeutic Use.
4′-Methyl-2,2′-bipyridine-4-carboxylic acid(Cat No.:M010096)is a heteroaromatic compound derived from bipyridine, featuring a methyl group at the 4′-position and a carboxylic acid group at the 4-position. This compound serves as a bidentate ligand in coordination chemistry, capable of forming stable complexes with various metal ions. Its electronic and steric properties make it valuable in the design of metal-based catalysts, sensors, and functional materials. The carboxylic acid group allows for further derivatization or surface attachment, while the bipyridine core is widely used in studies involving redox-active complexes and photochemical applications.
CAS Number | 103946-54-9 |
Molecular Formula | C12H10N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(4-methylpyridin-2-yl)pyridine-4-carboxylic acid |
InChI | InChI=1S/C12H10N2O2/c1-8-2-4-13-10(6-8)11-7-9(12(15)16)3-5-14-11/h2-7H,1H3,(H,15,16) |
InChIKey | LEJWPWXRHHUDRH-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC=C1)C2=NC=CC(=C2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |