For research use only. Not for therapeutic Use.
4-(Methoxycarbonyl)-2-methylphenylboronic acid is an organoboronic acid commonly used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions. Its structure, which includes a methoxycarbonyl group and a methyl group on a phenyl ring, allows for versatile reactivity in the formation of carbon-carbon bonds. This compound is valuable in pharmaceutical research for developing bioactive molecules and drug candidates. Its boronic acid functionality makes it a useful intermediate in the synthesis of complex organic compounds, contributing to advancements in medicinal chemistry.
CAS Number | 158429-38-0 |
Synonyms | 4-(Methoxycarbonyl)-2-methylphenylboronic acid |
Molecular Formula | C9H11BO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (4-methoxycarbonyl-2-methylphenyl)boronic acid |
InChI | InChI=1S/C9H11BO4/c1-6-5-7(9(11)14-2)3-4-8(6)10(12)13/h3-5,12-13H,1-2H3 |
InChIKey | MOBGLFACQCDFEQ-UHFFFAOYSA-N |
SMILES | B(C1=C(C=C(C=C1)C(=O)OC)C)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |