For research use only. Not for therapeutic Use.
4-Methoxybiphenyl-3-carboxylic acid(CAT: L003185) is a high-purity aromatic compound featuring a biphenyl core with a methoxy substitution at the 4-position and a carboxylic acid group at the 3-position. This versatile molecule is widely utilized in pharmaceutical and chemical research as a key intermediate in the synthesis of bioactive compounds and advanced organic materials. Its well-defined structure and reactivity make it valuable for medicinal chemistry applications, including the development of novel therapeutic agents. With reliable quality and excellent stability, 4-Methoxybiphenyl-3-carboxylic acid supports innovative research in drug discovery, organic synthesis, and material science.
| CAS Number | 107410-07-1 |
| Molecular Formula | C14H12O3 |
| Purity | ≥95% |
| IUPAC Name | 2-methoxy-5-phenylbenzoic acid |
| InChI | InChI=1S/C14H12O3/c1-17-13-8-7-11(9-12(13)14(15)16)10-5-3-2-4-6-10/h2-9H,1H3,(H,15,16) |
| InChIKey | NRUOSOAWSBPNPB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |