For research use only. Not for therapeutic Use.
4-methoxy-N-methylpyridin-2-amine(Cat No.:L007885), with the chemical formula C7H10N2O. This compound features a pyridine-2-amine core substituted with a methoxy group at the 4-position and a methyl group on the nitrogen atom. Compounds with similar structures are valuable in medicinal chemistry and drug discovery due to their potential biological activities. The unique arrangement of atoms in this compound provides opportunities for chemical modifications, enabling researchers to create diverse molecules with potential applications in the development of new drugs, probes for biological studies, and other specialized chemicals for scientific research and pharmaceutical applications.
CAS Number | 1104455-24-4 |
Molecular Formula | C7H10N2O |
Purity | ≥95% |
IUPAC Name | 4-methoxy-N-methylpyridin-2-amine |
InChI | InChI=1S/C7H10N2O/c1-8-7-5-6(10-2)3-4-9-7/h3-5H,1-2H3,(H,8,9) |
InChIKey | SMTQFLZEYWPDEZ-UHFFFAOYSA-N |
SMILES | CNC1=NC=CC(=C1)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |