For research use only. Not for therapeutic Use.
4-Mercaptobenzonitrile（Cat No.:L014165）is an aromatic compound featuring a thiol (-SH) group at the para (4-) position and a nitrile (-CN) group at the 1-position of a benzene ring. This bifunctional molecule is a valuable intermediate in organic synthesis, materials science, and surface chemistry. The thiol group readily binds to metal surfaces, particularly gold, making it useful in self-assembled monolayers (SAMs) and nanotechnology applications. The nitrile group offers further functionalization potential via transformations into amides, amines, or heterocycles. Its electron-rich and reactive structure supports use in sensor design, drug development, and molecular electronics.
| CAS Number | 36801-01-1 |
| Molecular Formula | C7H5NS |
| Purity | ≥95% |
| IUPAC Name | 4-sulfanylbenzonitrile |
| InChI | InChI=1S/C7H5NS/c8-5-6-1-3-7(9)4-2-6/h1-4,9H |
| InChIKey | MVPUXVBBHWUOFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)S |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
