For research use only. Not for therapeutic Use.
4-Mercaptobenzoic acid（Cat No.:R000183）is an aromatic compound featuring a carboxylic acid group at the 1-position and a thiol (-SH) group at the 4-position of a benzene ring. This bifunctional molecule is widely used in surface chemistry, particularly for forming self-assembled monolayers (SAMs) on gold and other metal surfaces due to the strong affinity of the thiol group. The carboxylic acid group offers further conjugation possibilities with biomolecules or polymers. 4-Mercaptobenzoic acid is valuable in sensor development, nanomaterials, and analytical applications such as surface-enhanced Raman spectroscopy (SERS).
| CAS Number | 1074-36-8 |
| Synonyms | NSC 32022; p-Carboxybenzenethiol; 4-Carboxythiophenol; |
| Molecular Formula | C7H6O2S |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 4-sulfanylbenzoic acid |
| InChI | InChI=1S/C7H6O2S/c8-7(9)5-1-3-6(10)4-2-5/h1-4,10H,(H,8,9) |
| InChIKey | LMJXSOYPAOSIPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)S |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
