For research use only. Not for therapeutic Use.
4-Mercapto-pentanoic acid(CAT: M106223) is a high-purity sulfur-containing aliphatic carboxylic acid featuring a thiol (-SH) group at the 4-position and a terminal carboxylic acid (-COOH) moiety. This versatile compound serves as a key building block in pharmaceutical research, organic synthesis, and biochemical studies. Its thiol group allows for selective reactivity, including thiol-based conjugations and redox chemistry, making it valuable for the preparation of bioactive molecules, chelating agents, and functionalized materials. 4-Mercapto-pentanoic acid is particularly useful in designing enzyme inhibitors and metal-binding compounds. With excellent stability and reactivity, it supports innovative developments in medicinal chemistry and material science applications.
CAS Number | 125791-83-5 |
Synonyms | 4-Mercapto-pentanoic acid |
Molecular Formula | C5H10O2S |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-sulfanylpentanoic acid |
InChI | InChI=1S/C5H10O2S/c1-4(8)2-3-5(6)7/h4,8H,2-3H2,1H3,(H,6,7) |
InChIKey | NEAFWRKPYYJETG-UHFFFAOYSA-N |
SMILES | CC(CCC(=O)O)S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |