4-(Maleimido)benzophenone（Cat No.:R000700） is a chemical compound used in bioconjugation and photolabeling applications. It contains a maleimide group, which selectively reacts with thiols, making it useful for attaching to cysteine residues in proteins and peptides. The benzophenone moiety is a photoreactive group that can form covalent bonds with nearby molecules upon exposure to ultraviolet (UV) light. This property allows for the precise labeling of biomolecules and the study of protein-protein interactions. 4-(Maleimido)benzophenone is valuable in biological research for its ability to introduce photoactivatable groups into proteins, enabling controlled manipulation of biological systems with light.
| Catalog Number | R000700 |
| CAS Number | 92944-71-3 |
| Synonyms | 1-(4-Benzoylphenyl)-1H-pyrrole-2,5-dione; N-(4-Benzoylphenyl)maleimide; |
| Molecular Formula | C17H11NO3 |
| Purity | 95% |
| Storage | Store at RT |
| IUPAC Name | 1-(4-benzoylphenyl)pyrrole-2,5-dione |
| InChI | InChI=1S/C17H11NO3/c19-15-10-11-16(20)18(15)14-8-6-13(7-9-14)17(21)12-4-2-1-3-5-12/h1-11H |
| InChIKey | OZIZEXQRIOURIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)N3C(=O)C=CC3=O |
