For research use only. Not for therapeutic Use.
4-Isopropyl-6-nitroquinolin-2(1H)-one is a nitrogen-containing heterocyclic compound with a quinolinone core. Substituted with an isopropyl group at the 4-position and a nitro group at the 6-position, it combines hydrophobic and electron-withdrawing features, making it highly reactive in synthetic chemistry. This compound is often used in pharmaceutical research for its potential to serve as an intermediate in the synthesis of bioactive molecules. Its structure supports applications in medicinal chemistry, especially in developing treatments targeting inflammation and microbial infections.
| CAS Number | 934687-46-4 |
| Molecular Formula | C12H12N2O3 |
| Purity | ≥95% |
| IUPAC Name | 6-nitro-4-propan-2-yl-1H-quinolin-2-one |
| InChI | InChI=1S/C12H12N2O3/c1-7(2)9-6-12(15)13-11-4-3-8(14(16)17)5-10(9)11/h3-7H,1-2H3,(H,13,15) |
| InChIKey | WAPFHSYDMIRBIZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=O)NC2=C1C=C(C=C2)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |