For research use only. Not for therapeutic Use.
4-Isobutyl-2-pyrrolidinone (Cat No.: R009868) is a substituted pyrrolidinone compound featuring an isobutyl group at the 4-position of a five-membered lactam ring. This structure combines lipophilicity from the isobutyl side chain with the polarity of the lactam, making it a versatile intermediate in pharmaceutical and chemical synthesis. It is commonly used in the development of bioactive molecules, including central nervous system agents. Its unique balance of solubility and reactivity also makes it suitable for applications in polymer chemistry and specialty materials.
| CAS Number | 61312-87-6 |
| Synonyms | 4-(2-Methylpropyl)-2-pyrrolidinone; |
| Molecular Formula | C8H15NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-(2-methylpropyl)pyrrolidin-2-one |
| InChI | InChI=1S/C8H15NO/c1-6(2)3-7-4-8(10)9-5-7/h6-7H,3-5H2,1-2H3,(H,9,10) |
| InChIKey | GUGXRXLTTHFKHC-UHFFFAOYSA-N |
| SMILES | CC(C)CC1CC(=O)NC1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
