Inhibitor of macrophage migration inhibitory factor (MIF). Acts as a suicide substrate to inactivate MIF catalytic and biological functions; inhibits MIF-associated liver enzyme activity <em>in vivo</em>. Also inhibits migration and anchorage independence of human lung adenocarcinoma cell lines <em>in vitro</em>.
| Catalog Number | I010763 |
| CAS Number | 41270-96-6 |
| Synonyms | 4-Iodo-6-phenylpyrimidine |
| Molecular Formula | C10H7IN2 |
| Purity | 95% |
| Solubility | Soluble to 100 mM in DMSO and to 50 mM in ethanol |
| Storage | Store at +4C |
| IUPAC Name | 4-iodo-6-phenylpyrimidine |
| InChI | InChI=1S/C10H7IN2/c11-10-6-9(12-7-13-10)8-4-2-1-3-5-8/h1-7H |
| InChIKey | ZTCJXHNJVLUUMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC=N2)I |
