For research use only. Not for therapeutic Use.
4-Iodocyclohexanamine hydrochloride(CAT: L029686) is an organic compound with an iodinated cyclohexane ring and an amine group at the 4th position, existing as a hydrochloride salt. This structure provides the compound with enhanced solubility and stability, making it useful in various chemical and pharmaceutical research applications. The presence of iodine makes it a valuable intermediate for further functionalization in the synthesis of bioactive molecules or radiolabeling studies. Its amine group also allows it to participate in amide coupling reactions, which are crucial in drug design and medicinal chemistry. This compound can serve as a building block in the development of pharmaceuticals, agrochemicals, and other fine chemicals.
| CAS Number | 1353965-61-3 |
| Molecular Formula | C6H13ClIN |
| Purity | ≥95% |
| IUPAC Name | 4-iodocyclohexan-1-amine;hydrochloride |
| InChI | InChI=1S/C6H12IN.ClH/c7-5-1-3-6(8)4-2-5;/h5-6H,1-4,8H2;1H |
| InChIKey | HYHRKYVNMVEQPD-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |