For research use only. Not for therapeutic Use.
4-Iodo-1-methylpyridin-2(1H)-one(Cat No.:L031958)is a valuable intermediate in organic synthesis, particularly in the pharmaceutical and chemical research sectors. This compound features an iodine atom and a methyl group attached to a pyridinone ring, offering significant reactivity for the construction of complex molecular structures. It is commonly used in the development of active pharmaceutical ingredients (APIs) and other fine chemicals, serving as a key building block in various synthetic pathways. Its high purity and stability make it essential for researchers and chemists engaged in innovative compound development and drug discovery projects.
CAS Number | 889865-47-8 |
Molecular Formula | C6H6INO |
Purity | ≥95% |
IUPAC Name | 4-iodo-1-methylpyridin-2-one |
InChI | InChI=1S/C6H6INO/c1-8-3-2-5(7)4-6(8)9/h2-4H,1H3 |
InChIKey | YZJCNADFGXFEHX-UHFFFAOYSA-N |
SMILES | CN1C=CC(=CC1=O)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |