For research use only. Not for therapeutic Use.
4-Hydroxythiobenzamide(CAT: R018369) is a sulfur- and oxygen-containing aromatic compound featuring both a hydroxyl group and a thioamide functionality on a benzene ring. Typically used as an intermediate in organic synthesis, it plays a role in developing sulfur-containing heterocycles, pharmaceuticals, and biologically active compounds. The presence of electron-donating and electron-withdrawing groups allows for versatile reactivity, making it suitable for studying nucleophilic substitution, condensation, and cyclization reactions. Its structure is also of interest in coordination chemistry and biochemical probe design.
CAS Number | 25984-63-8 |
Synonyms | p-Hydroxythio-benzamide; 4-Hydroxybenzenecarbothioamide; 4-Hydroxybenzenethiocarboxamide; 4-Hydroxybenzothioamide; 4-Hydroxythiobenzamide; p-Hydroxythiobenzamide |
Molecular Formula | C7H7NOS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[amino(sulfanyl)methylidene]cyclohexa-2,5-dien-1-one |
InChI | InChI=1S/C7H7NOS/c8-7(10)5-1-3-6(9)4-2-5/h1-4,10H,8H2 |
InChIKey | DOCQBKMMNPJLOR-UHFFFAOYSA-N |
SMILES | C1=CC(=O)C=CC1=C(N)S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |