For research use only. Not for therapeutic Use.
4-Hydroxycarbazeran(Cat No.:R040010)is a chemical compound featuring a hydroxy group attached to the carbazeran scaffold, a tricyclic aromatic structure. It is of interest in pharmaceutical research due to its potential biological activities and role as an intermediate in synthesizing more complex molecules. The presence of the hydroxy group enhances its reactivity, allowing for further chemical modifications. This compound is studied for its potential therapeutic applications, including anti-inflammatory, anti-cancer, and neuroprotective effects. Its unique structure makes it valuable in developing new drugs and understanding various biochemical pathways.
CAS Number | 96724-43-5 |
Synonyms | 1-(3,4-Dihydro-6,7-dimethoxy-4-oxo-1-phthalazinyl)-4-piperidinyl Ester Ethylcarbamic Acid |
Molecular Formula | C18H24N4O5 |
Purity | 95% |
Storage | Store at RT |
IUPAC Name | [1-(6,7-dimethoxy-4-oxo-3H-phthalazin-1-yl)piperidin-4-yl] N-ethylcarbamate |
InChI | InChI=1S/C18H24N4O5/c1-4-19-18(24)27-11-5-7-22(8-6-11)16-12-9-14(25-2)15(26-3)10-13(12)17(23)21-20-16/h9-11H,4-8H2,1-3H3,(H,19,24)(H,21,23) |
InChIKey | YIFOKLMSOFKZBP-UHFFFAOYSA-N |
SMILES | CCNC(=O)OC1CCN(CC1)C2=NNC(=O)C3=CC(=C(C=C32)OC)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |