For research use only. Not for therapeutic Use.
4-Hydroxybutyric Acid Hydrazide(Cat No.:L014048)is an organic compound used in pharmaceutical research and organic synthesis. It features a hydrazide group attached to 4-hydroxybutyric acid, providing both nucleophilic and electrophilic reactivity. This compound is particularly valuable as an intermediate in the synthesis of various biologically active molecules, including potential therapeutic agents. Its structure allows for the formation of amide bonds, making it useful in peptide synthesis and drug development. Researchers utilize this compound for its versatility in creating complex molecular frameworks in medicinal chemistry and biochemical studies.
CAS Number | 3879-08-1 |
Molecular Formula | C4H10N2O2 |
Purity | ≥95% |
IUPAC Name | 4-hydroxybutanehydrazide |
InChI | InChI=1S/C4H10N2O2/c5-6-4(8)2-1-3-7/h7H,1-3,5H2,(H,6,8) |
InChIKey | WOXQFPPKZBOSTN-UHFFFAOYSA-N |
SMILES | C(CC(=O)NN)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |