For research use only. Not for therapeutic Use.
4-Hydroxybenzamidine hydrochloride (Cat No.: R001369) is a crystalline compound featuring a benzamidine core with a hydroxyl group at the para-position and is typically supplied as a hydrochloride salt for stability and solubility. It acts as a selective inhibitor of serine proteases such as trypsin and thrombin, making it valuable in enzymology and anticoagulation research. Its structure allows for hydrogen bonding and electrostatic interactions with enzyme active sites. Commonly used in biochemical assays, it also serves as a building block in medicinal chemistry.
| CAS Number | 38148-63-9 |
| Synonyms | 4-Hydroxy-benzenecarboximidamide Hydrochloride; 4-Amidinophenol Hydrochloride; p-Hydroxybenzamidine Monohydrochloride; |
| Molecular Formula | C7H9ClN2O |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 4-(diaminomethylidene)cyclohexa-2,5-dien-1-one;hydrochloride |
| InChI | InChI=1S/C7H8N2O.ClH/c8-7(9)5-1-3-6(10)4-2-5;/h1-4H,8-9H2;1H |
| InChIKey | OADOZRQXRQAJDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)C=CC1=C(N)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
