For research use only. Not for therapeutic Use.
4-Hydroxybenzaldehyde (Cat.No:R040793) is an organic compound with a phenolic and an aldehyde functional group. It is commonly used in the synthesis of various pharmaceuticals, agrochemicals, and perfumes. Additionally, it serves as a precursor in the production of flavors and fragrances, making it a versatile compound in the chemical industry.
| CAS Number | 123-08-0 |
| Synonyms | p-hydroxybenzaldehyde; 4-Formylphenol; NSC 2127; Parahydroxybenzaldehyde; p-Formylphenol; p-Hydroxybenzaldehyde; p-Oxybenzaldehyde |
| Molecular Formula | C7H6O2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | 4-hydroxybenzaldehyde |
| InChI | InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H |
| InChIKey | RGHHSNMVTDWUBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
