For research use only. Not for therapeutic Use.
4-Hydroxy-L-threonine is an amino acid derivative. It consists of a threonine molecule, a standard amino acid, with an additional hydroxyl group (-OH) attached to the fourth carbon atom of the molecule. This modification gives it unique properties and potential applications in biochemical and pharmaceutical research, particularly in the study of protein structure and function or as a building block in the synthesis of biologically active compounds.
| CAS Number | 21768-45-6 |
| Synonyms | 4-Hydroxythreonine; L-threo-α-Amino-β,γ-dihydroxybutyric acid; L-γ-Hydroxythreonine; 2-Amino-2-deoxythreonic Acid; |
| Molecular Formula | C4H9NO4 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | (2S,3S)-2-amino-3,4-dihydroxybutanoic acid |
| InChI | InChI=1S/C4H9NO4/c5-3(4(8)9)2(7)1-6/h2-3,6-7H,1,5H2,(H,8,9)/t2-,3+/m1/s1 |
| InChIKey | JBNUARFQOCGDRK-GBXIJSLDSA-N |
| SMILES | C(C(C(C(=O)O)N)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |