Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-Hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylic acid
For research use only. Not for therapeutic Use.
4-Hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylic acid(CAT: L000531) is a chemically significant compound with potential applications in pharmaceutical and organic chemistry. Its action method primarily involves its role as a key intermediate for the synthesis of various compounds. In pharmaceutical chemistry, it can serve as a valuable building block for the creation of potential drug candidates and bioactive molecules due to its specific structure.
| CAS Number | 1421312-35-7 |
| Molecular Formula | C17H13NO4 |
| Purity | ≥95% |
| IUPAC Name | 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylic acid |
| InChI | InChI=1S/C17H13NO4/c1-10-14-9-12(22-11-5-3-2-4-6-11)7-8-13(14)16(19)15(18-10)17(20)21/h2-9,19H,1H3,(H,20,21) |
| InChIKey | RQLQUCXIJNHBDY-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |