For research use only. Not for therapeutic Use.
4-Formylcolchicine(Cat No.:I042648)is a chemical derivative of colchicine, a well-known alkaloid used for its anti-inflammatory and anticancer properties. The modification involves the introduction of a formyl group at the 4-position of the colchicine structure, which may alter its bioactivity and pharmacokinetics. Like colchicine, 4-formylcolchicine has potential therapeutic applications in cancer treatment, particularly in disrupting microtubule dynamics, which are essential for cell division. Additionally, its anti-inflammatory properties could be leveraged in conditions such as gout or arthritis. Further research is needed to explore its full therapeutic potential and possible advantages over colchicine.
CAS Number | 2730-82-7 |
Synonyms | N-[(7S)-4-formyl-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
Molecular Formula | C23H25NO7 |
Purity | ≥95% |
IUPAC Name | N-[(7S)-4-formyl-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
InChI | InChI=1S/C23H25NO7/c1-12(26)24-17-8-6-14-16(11-25)21(29-3)23(31-5)22(30-4)20(14)13-7-9-19(28-2)18(27)10-15(13)17/h7,9-11,17H,6,8H2,1-5H3,(H,24,26)/t17-/m0/s1 |
InChIKey | JUWAUXATKRGHCK-KRWDZBQOSA-N |
SMILES | CC(=O)N[C@H]1CCC2=C(C(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |