For research use only. Not for therapeutic Use.
4-Fluorophenol (Cat No.: R019153) is an aromatic organic compound featuring a hydroxyl group (-OH) and a fluorine atom substituted at the para (4) positions on a benzene ring. It appears as a colorless to pale yellow solid or liquid with a characteristic phenolic odor. 4-Fluorophenol is used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and dyes. The fluorine atom enhances the compound’s metabolic stability and alters its electronic properties, making it valuable in medicinal chemistry for designing bioactive molecules and drug candidates.
| CAS Number | 371-41-5 |
| Synonyms | 4-Hydroxyphenyl fluoride; NSC 10295; p-Fluorophenol |
| Molecular Formula | C6H5FO |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 4-fluorophenol |
| InChI | InChI=1S/C6H5FO/c7-5-1-3-6(8)4-2-5/h1-4,8H |
| InChIKey | RHMPLDJJXGPMEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
