For research use only. Not for therapeutic Use.
4-Fluorocinnamaldehyde(Cat No.:L016793)is an aromatic aldehyde featuring a fluorine atom at the 4-position of a cinnamaldehyde structure. This compound is widely used in pharmaceutical research, organic synthesis, and flavor chemistry. The presence of the fluorine atom enhances the compound’s reactivity and metabolic stability, making it a valuable building block in the development of bioactive molecules, including potential drug candidates. Its conjugated aldehyde system allows for versatile chemical transformations, such as condensation and polymerization reactions. High purity ensures consistent performance in advanced research and synthesis applications.
CAS Number | 51791-26-5 |
Molecular Formula | C9H7FO |
Purity | ≥95% |
IUPAC Name | (E)-3-(4-fluorophenyl)prop-2-enal |
InChI | InChI=1S/C9H7FO/c10-9-5-3-8(4-6-9)2-1-7-11/h1-7H/b2-1+ |
InChIKey | YSIYEWBILJZDQH-OWOJBTEDSA-N |
SMILES | C1=CC(=CC=C1C=CC=O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |