For research use only. Not for therapeutic Use.
4′-Fluorobutyrophenone(CAT: L020983) is a high-purity aromatic ketone widely utilized in pharmaceutical, chemical, and organic synthesis research. Featuring a fluorine atom on the phenyl ring and a butyrophenone backbone, this compound serves as a versatile intermediate in the development of bioactive molecules, fine chemicals, and advanced materials. It is particularly valuable in medicinal chemistry for the synthesis of therapeutic agents and the exploration of structure-activity relationships. With excellent stability and reactivity, 4′-Fluorobutyrophenone ensures precision and reliability, making it an essential tool for innovative research and advanced synthetic applications.
| CAS Number | 582-83-2 |
| Molecular Formula | C10H11FO |
| Purity | ≥95% |
| IUPAC Name | 1-(4-fluorophenyl)butan-1-one |
| InChI | InChI=1S/C10H11FO/c1-2-3-10(12)8-4-6-9(11)7-5-8/h4-7H,2-3H2,1H3 |
| InChIKey | QHDXPJMOWRLLRV-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=CC=C(C=C1)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |