For research use only. Not for therapeutic Use.
4-Fluorobenzylamine(CAT: R010028) is an aromatic amine featuring a fluorine substituent at the para-position of the benzyl ring. This compound is a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals, where the fluorine atom enhances metabolic stability and modulates electronic properties. The primary amine functionality allows for easy incorporation into amides, ureas, imines, and heterocyclic frameworks. 4-Fluorobenzylamine is commonly employed in the development of CNS-active agents, enzyme inhibitors, and radiolabeled tracers. Its balance of reactivity and structural simplicity makes it a versatile building block in medicinal chemistry, structure-activity relationship (SAR) studies, and custom organic synthesis.
| CAS Number | 140-75-0 |
| Synonyms | 4-Fluorobenzenemethanamine; (4-Fluorophenyl)methanamine; 1-(4-Fluorophenyl)methanamine; NSC 158269; [(4-Fluorophenyl)methyl]amine; p-Fluorobenzylamine; |
| Molecular Formula | C7H8FN |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (4-fluorophenyl)methanamine |
| InChI | InChI=1S/C7H8FN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
| InChIKey | IIFVWLUQBAIPMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |