(4-Fluoro-2,6-dimethoxyphenyl)boronic acid(CAT: L000211) is a vital compound in organic chemistry, especially in the synthesis of pharmaceutical and organic molecules. It serves as a crucial intermediate for creating various organic compounds, including pharmaceutical agents and agrochemicals. The boronic acid functionality is essential for cross-coupling reactions, enabling the formation of complex molecular structures.
| Catalog Number | L000211 |
| CAS Number | 512186-38-8 |
| Molecular Formula | C8H10BFO4 |
| Purity | 95% |
| IUPAC Name | (4-fluoro-2,6-dimethoxyphenyl)boronic acid |
| InChI | InChI=1S/C8H10BFO4/c1-13-6-3-5(10)4-7(14-2)8(6)9(11)12/h3-4,11-12H,1-2H3 |
| InChIKey | QUFXJRGXNFZZGI-UHFFFAOYSA-N |
