For research use only. Not for therapeutic Use.
(4-Fluoro-2,6-dimethoxyphenyl)boronic acid(CAT: L000211) is a vital compound in organic chemistry, especially in the synthesis of pharmaceutical and organic molecules. It serves as a crucial intermediate for creating various organic compounds, including pharmaceutical agents and agrochemicals. The boronic acid functionality is essential for cross-coupling reactions, enabling the formation of complex molecular structures.
CAS Number | 512186-38-8 |
Molecular Formula | C8H10BFO4 |
Purity | ≥95% |
IUPAC Name | (4-fluoro-2,6-dimethoxyphenyl)boronic acid |
InChI | InChI=1S/C8H10BFO4/c1-13-6-3-5(10)4-7(14-2)8(6)9(11)12/h3-4,11-12H,1-2H3 |
InChIKey | QUFXJRGXNFZZGI-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |